C15H14BrN3O2 — CID 66462324
6-bromo-N-[2-[2-(methylamino)-2-oxoethyl]phenyl]pyridine-3-carboxamide (PubChem CID 66462324) has the molecular formula C15H14BrN3O2 and a molecular weight of 348.20 g/mol. Its IUPAC name is 6-bromo-N-[2-[2-(methylamino)-2-oxoethyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 6-bromo-N-[2-[2-(methylamino)-2-oxoethyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66462324 |
| Molecular Formula | C15H14BrN3O2 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 6-bromo-N-[2-[2-(methylamino)-2-oxoethyl]phenyl]pyridine-3-carboxamide |
| SMILES | CNC(=O)Cc1ccccc1NC(=O)c1ccc(Br)nc1 |
| InChI | InChI=1S/C15H14BrN3O2/c1-17-14(20)8-10-4-2-3-5-12(10)19-15(21)11-6-7-13(16)18-9-11/h2-7,9H,8H2,1H3,(H,17,20)(H,19,21) |
| InChIKey | MBABNACOSOEVTG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|