C14H14ClN3O — CID 66463234
3-chloro-N-methyl-N-(2-pyridin-2-ylethyl)pyridine-4-carboxamide (PubChem CID 66463234) has the molecular formula C14H14ClN3O and a molecular weight of 275.74 g/mol. Its IUPAC name is 3-chloro-N-methyl-N-(2-pyridin-2-ylethyl)pyridine-4-carboxamide.
| Compound Name | 3-chloro-N-methyl-N-(2-pyridin-2-ylethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 66463234 |
| Molecular Formula | C14H14ClN3O |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 3-chloro-N-methyl-N-(2-pyridin-2-ylethyl)pyridine-4-carboxamide |
| SMILES | CN(CCc1ccccn1)C(=O)c1ccncc1Cl |
| InChI | InChI=1S/C14H14ClN3O/c1-18(9-6-11-4-2-3-7-17-11)14(19)12-5-8-16-10-13(12)15/h2-5,7-8,10H,6,9H2,1H3 |
| InChIKey | PPXLMYNVEOTCAM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |