About 4-butoxy-5H-pyrimido[5,4-b]indole
4-butoxy-5H-pyrimido[5,4-b]indole (PubChem CID 664633) has the molecular formula C14H15N3O
and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-butoxy-5H-pyrimido[5,4-b]indole.
Molecular Properties
| Compound Name | 4-butoxy-5H-pyrimido[5,4-b]indole |
| PubChem CID | 664633 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 4-butoxy-5H-pyrimido[5,4-b]indole |
| SMILES | CCCCOc1ncnc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C14H15N3O/c1-2-3-8-18-14-13-12(15-9-16-14)10-6-4-5-7-11(10)17-13/h4-7,9,17H,2-3,8H2,1H3 |
| InChIKey | UFUHRERRUSFQEI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxy-5H-pyrimido[5,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxy-5H-pyrimido[5,4-b]indole?
The IUPAC name of 4-butoxy-5H-pyrimido[5,4-b]indole (CID 664633) is 4-butoxy-5H-pyrimido[5,4-b]indole.
What is the SMILES notation for 4-butoxy-5H-pyrimido[5,4-b]indole?
The canonical SMILES for 4-butoxy-5H-pyrimido[5,4-b]indole is CCCCOc1ncnc2c1[nH]c1ccccc12.
What is the InChIKey of 4-butoxy-5H-pyrimido[5,4-b]indole?
The InChIKey is UFUHRERRUSFQEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O/c1-2-3-8-18-14-13-12(15-9-16-14)10-6-4-5-7-11(10)17-13/h4-7,9,17H,2-3,8H2,1H3.
What are the key properties of 4-butoxy-5H-pyrimido[5,4-b]indole?
4-butoxy-5H-pyrimido[5,4-b]indole has a molecular weight of 241.29 g/mol, XLogP of 3.29, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxy-5H-pyrimido[5,4-b]indole is sourced from PubChem (CID 664633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).