C10H11BrN2O3 — CID 66463637
2-[(6-bromopyridine-3-carbonyl)amino]-2-methylpropanoic acid (PubChem CID 66463637) has the molecular formula C10H11BrN2O3 and a molecular weight of 287.11 g/mol. Its IUPAC name is 2-[(6-bromopyridine-3-carbonyl)amino]-2-methylpropanoic acid.
| Compound Name | 2-[(6-bromopyridine-3-carbonyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 66463637 |
| Molecular Formula | C10H11BrN2O3 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 2-[(6-bromopyridine-3-carbonyl)amino]-2-methylpropanoic acid |
| SMILES | CC(C)(NC(=O)c1ccc(Br)nc1)C(=O)O |
| InChI | InChI=1S/C10H11BrN2O3/c1-10(2,9(15)16)13-8(14)6-3-4-7(11)12-5-6/h3-5H,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | PVBLCONPUPZIHU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|