C15H17BrN2O2 — CID 66463920
6-bromo-N-[(5-methylfuran-2-yl)methyl]-N-propan-2-ylpyridine-3-carboxamide (PubChem CID 66463920) has the molecular formula C15H17BrN2O2 and a molecular weight of 337.22 g/mol. Its IUPAC name is 6-bromo-N-[(5-methylfuran-2-yl)methyl]-N-propan-2-ylpyridine-3-carboxamide.
| Compound Name | 6-bromo-N-[(5-methylfuran-2-yl)methyl]-N-propan-2-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 66463920 |
| Molecular Formula | C15H17BrN2O2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 6-bromo-N-[(5-methylfuran-2-yl)methyl]-N-propan-2-ylpyridine-3-carboxamide |
| SMILES | Cc1ccc(CN(C(=O)c2ccc(Br)nc2)C(C)C)o1 |
| InChI | InChI=1S/C15H17BrN2O2/c1-10(2)18(9-13-6-4-11(3)20-13)15(19)12-5-7-14(16)17-8-12/h4-8,10H,9H2,1-3H3 |
| InChIKey | PDDHLMLRIXYURZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|