About 3-(3-bromophenyl)sulfanyl-1,1,1-trifluoropropan-2-one
3-(3-bromophenyl)sulfanyl-1,1,1-trifluoropropan-2-one (PubChem CID 66465411) has the molecular formula C9H6BrF3OS
and a molecular weight of 299.11 g/mol. Its IUPAC name is 3-(3-bromophenyl)sulfanyl-1,1,1-trifluoropropan-2-one.
Molecular Properties
| Compound Name | 3-(3-bromophenyl)sulfanyl-1,1,1-trifluoropropan-2-one |
| PubChem CID | 66465411 |
| Molecular Formula | C9H6BrF3OS |
| Molecular Weight | 299.11 g/mol |
| Exact Mass | 297.93 |
| IUPAC Name | 3-(3-bromophenyl)sulfanyl-1,1,1-trifluoropropan-2-one |
| SMILES | O=C(CSc1cccc(Br)c1)C(F)(F)F |
| InChI | InChI=1S/C9H6BrF3OS/c10-6-2-1-3-7(4-6)15-5-8(14)9(11,12)13/h1-4H,5H2 |
| InChIKey | IISVSAKQYBVABG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.11 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3-bromophenyl)sulfanyl-1,1,1-trifluoropropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromophenyl)sulfanyl-1,1,1-trifluoropropan-2-one?
The IUPAC name of 3-(3-bromophenyl)sulfanyl-1,1,1-trifluoropropan-2-one (CID 66465411) is 3-(3-bromophenyl)sulfanyl-1,1,1-trifluoropropan-2-one.
What is the SMILES notation for 3-(3-bromophenyl)sulfanyl-1,1,1-trifluoropropan-2-one?
The canonical SMILES for 3-(3-bromophenyl)sulfanyl-1,1,1-trifluoropropan-2-one is O=C(CSc1cccc(Br)c1)C(F)(F)F.
What is the InChIKey of 3-(3-bromophenyl)sulfanyl-1,1,1-trifluoropropan-2-one?
The InChIKey is IISVSAKQYBVABG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrF3OS/c10-6-2-1-3-7(4-6)15-5-8(14)9(11,12)13/h1-4H,5H2.
What are the key properties of 3-(3-bromophenyl)sulfanyl-1,1,1-trifluoropropan-2-one?
3-(3-bromophenyl)sulfanyl-1,1,1-trifluoropropan-2-one has a molecular weight of 299.11 g/mol, XLogP of 3.67, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromophenyl)sulfanyl-1,1,1-trifluoropropan-2-one is sourced from PubChem (CID 66465411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).