C11H14ClN5 — CID 66466424
2-(chloromethyl)-6-(3,5-diethyl-1,2,4-triazol-1-yl)pyrazine (PubChem CID 66466424) has the molecular formula C11H14ClN5 and a molecular weight of 251.72 g/mol. Its IUPAC name is 2-(chloromethyl)-6-(3,5-diethyl-1,2,4-triazol-1-yl)pyrazine.
| Compound Name | 2-(chloromethyl)-6-(3,5-diethyl-1,2,4-triazol-1-yl)pyrazine |
|---|---|
| PubChem CID | 66466424 |
| Molecular Formula | C11H14ClN5 |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2-(chloromethyl)-6-(3,5-diethyl-1,2,4-triazol-1-yl)pyrazine |
| SMILES | CCc1nc(CC)n(-c2cncc(CCl)n2)n1 |
| InChI | InChI=1S/C11H14ClN5/c1-3-9-15-10(4-2)17(16-9)11-7-13-6-8(5-12)14-11/h6-7H,3-5H2,1-2H3 |
| InChIKey | RZIAKWKETQPQEW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|