C15H23N — CID 66466694
2-(2,4-dimethylphenyl)-2-propylpyrrolidine (PubChem CID 66466694) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-2-propylpyrrolidine.
| Compound Name | 2-(2,4-dimethylphenyl)-2-propylpyrrolidine |
|---|---|
| PubChem CID | 66466694 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-2-propylpyrrolidine |
| SMILES | CCCC1(c2ccc(C)cc2C)CCCN1 |
| InChI | InChI=1S/C15H23N/c1-4-8-15(9-5-10-16-15)14-7-6-12(2)11-13(14)3/h6-7,11,16H,4-5,8-10H2,1-3H3 |
| InChIKey | OBSGWLOHZTZQLE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |