About N-[[6-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]methyl]ethanamine
N-[[6-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]methyl]ethanamine (PubChem CID 66467965) has the molecular formula C10H14F3N3O
and a molecular weight of 249.24 g/mol. Its IUPAC name is N-[[6-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[6-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]methyl]ethanamine |
| PubChem CID | 66467965 |
| Molecular Formula | C10H14F3N3O |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | N-[[6-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]methyl]ethanamine |
| SMILES | CCNCc1cncc(OC(C)C(F)(F)F)n1 |
| InChI | InChI=1S/C10H14F3N3O/c1-3-14-4-8-5-15-6-9(16-8)17-7(2)10(11,12)13/h5-7,14H,3-4H2,1-2H3 |
| InChIKey | UQXQOTHZGCQUCY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[6-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[6-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]methyl]ethanamine?
The IUPAC name of N-[[6-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]methyl]ethanamine (CID 66467965) is N-[[6-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]methyl]ethanamine.
What is the SMILES notation for N-[[6-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]methyl]ethanamine?
The canonical SMILES for N-[[6-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]methyl]ethanamine is CCNCc1cncc(OC(C)C(F)(F)F)n1.
What is the InChIKey of N-[[6-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]methyl]ethanamine?
The InChIKey is UQXQOTHZGCQUCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3N3O/c1-3-14-4-8-5-15-6-9(16-8)17-7(2)10(11,12)13/h5-7,14H,3-4H2,1-2H3.
What are the key properties of N-[[6-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]methyl]ethanamine?
N-[[6-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]methyl]ethanamine has a molecular weight of 249.24 g/mol, XLogP of 1.92, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[6-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]methyl]ethanamine is sourced from PubChem (CID 66467965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).