About 2-tert-butyl-2-[(2,4-dichlorophenyl)methyl]pyrrolidine
2-tert-butyl-2-[(2,4-dichlorophenyl)methyl]pyrrolidine (PubChem CID 66468111) has the molecular formula C15H21Cl2N
and a molecular weight of 286.25 g/mol. Its IUPAC name is 2-tert-butyl-2-[(2,4-dichlorophenyl)methyl]pyrrolidine.
Molecular Properties
| Compound Name | 2-tert-butyl-2-[(2,4-dichlorophenyl)methyl]pyrrolidine |
| PubChem CID | 66468111 |
| Molecular Formula | C15H21Cl2N |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-tert-butyl-2-[(2,4-dichlorophenyl)methyl]pyrrolidine |
| SMILES | CC(C)(C)C1(Cc2ccc(Cl)cc2Cl)CCCN1 |
| InChI | InChI=1S/C15H21Cl2N/c1-14(2,3)15(7-4-8-18-15)10-11-5-6-12(16)9-13(11)17/h5-6,9,18H,4,7-8,10H2,1-3H3 |
| InChIKey | NKBFKEXULJBHPP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butyl-2-[(2,4-dichlorophenyl)methyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-2-[(2,4-dichlorophenyl)methyl]pyrrolidine?
The IUPAC name of 2-tert-butyl-2-[(2,4-dichlorophenyl)methyl]pyrrolidine (CID 66468111) is 2-tert-butyl-2-[(2,4-dichlorophenyl)methyl]pyrrolidine.
What is the SMILES notation for 2-tert-butyl-2-[(2,4-dichlorophenyl)methyl]pyrrolidine?
The canonical SMILES for 2-tert-butyl-2-[(2,4-dichlorophenyl)methyl]pyrrolidine is CC(C)(C)C1(Cc2ccc(Cl)cc2Cl)CCCN1.
What is the InChIKey of 2-tert-butyl-2-[(2,4-dichlorophenyl)methyl]pyrrolidine?
The InChIKey is NKBFKEXULJBHPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21Cl2N/c1-14(2,3)15(7-4-8-18-15)10-11-5-6-12(16)9-13(11)17/h5-6,9,18H,4,7-8,10H2,1-3H3.
What are the key properties of 2-tert-butyl-2-[(2,4-dichlorophenyl)methyl]pyrrolidine?
2-tert-butyl-2-[(2,4-dichlorophenyl)methyl]pyrrolidine has a molecular weight of 286.25 g/mol, XLogP of 4.70, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-2-[(2,4-dichlorophenyl)methyl]pyrrolidine is sourced from PubChem (CID 66468111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).