About [6-(N,3,5-trimethylanilino)pyrazin-2-yl]methanol
[6-(N,3,5-trimethylanilino)pyrazin-2-yl]methanol (PubChem CID 66468434) has the molecular formula C14H17N3O
and a molecular weight of 243.31 g/mol. Its IUPAC name is [6-(N,3,5-trimethylanilino)pyrazin-2-yl]methanol.
Molecular Properties
| Compound Name | [6-(N,3,5-trimethylanilino)pyrazin-2-yl]methanol |
| PubChem CID | 66468434 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | [6-(N,3,5-trimethylanilino)pyrazin-2-yl]methanol |
| SMILES | Cc1cc(C)cc(N(C)c2cncc(CO)n2)c1 |
| InChI | InChI=1S/C14H17N3O/c1-10-4-11(2)6-13(5-10)17(3)14-8-15-7-12(9-18)16-14/h4-8,18H,9H2,1-3H3 |
| InChIKey | OZBYNZGUVZMFGR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [6-(N,3,5-trimethylanilino)pyrazin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(N,3,5-trimethylanilino)pyrazin-2-yl]methanol?
The IUPAC name of [6-(N,3,5-trimethylanilino)pyrazin-2-yl]methanol (CID 66468434) is [6-(N,3,5-trimethylanilino)pyrazin-2-yl]methanol.
What is the SMILES notation for [6-(N,3,5-trimethylanilino)pyrazin-2-yl]methanol?
The canonical SMILES for [6-(N,3,5-trimethylanilino)pyrazin-2-yl]methanol is Cc1cc(C)cc(N(C)c2cncc(CO)n2)c1.
What is the InChIKey of [6-(N,3,5-trimethylanilino)pyrazin-2-yl]methanol?
The InChIKey is OZBYNZGUVZMFGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O/c1-10-4-11(2)6-13(5-10)17(3)14-8-15-7-12(9-18)16-14/h4-8,18H,9H2,1-3H3.
What are the key properties of [6-(N,3,5-trimethylanilino)pyrazin-2-yl]methanol?
[6-(N,3,5-trimethylanilino)pyrazin-2-yl]methanol has a molecular weight of 243.31 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(N,3,5-trimethylanilino)pyrazin-2-yl]methanol is sourced from PubChem (CID 66468434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).