C15H25N3O — CID 66468887
5-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-3-butan-2-yl-1,2,4-oxadiazole (PubChem CID 66468887) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 5-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-3-butan-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-3-butan-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 66468887 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 5-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-3-butan-2-yl-1,2,4-oxadiazole |
| SMILES | CCC(C)c1noc(C2CCC3CCCCC3N2)n1 |
| InChI | InChI=1S/C15H25N3O/c1-3-10(2)14-17-15(19-18-14)13-9-8-11-6-4-5-7-12(11)16-13/h10-13,16H,3-9H2,1-2H3 |
| InChIKey | HCHRALVCCABUKR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |