C16H28N4 — CID 66469543
2-[2-methyl-5-(2-methylpropyl)-1,2,4-triazol-3-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline (PubChem CID 66469543) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is 2-[2-methyl-5-(2-methylpropyl)-1,2,4-triazol-3-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline.
| Compound Name | 2-[2-methyl-5-(2-methylpropyl)-1,2,4-triazol-3-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
|---|---|
| PubChem CID | 66469543 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 2-[2-methyl-5-(2-methylpropyl)-1,2,4-triazol-3-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
| SMILES | CC(C)Cc1nc(C2CCC3CCCCC3N2)n(C)n1 |
| InChI | InChI=1S/C16H28N4/c1-11(2)10-15-18-16(20(3)19-15)14-9-8-12-6-4-5-7-13(12)17-14/h11-14,17H,4-10H2,1-3H3 |
| InChIKey | XHDKUCHOLHFWGS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |