C14H25F3N2 — CID 66469817
N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-N-ethyl-2,2,2-trifluoroethanamine (PubChem CID 66469817) has the molecular formula C14H25F3N2 and a molecular weight of 278.36 g/mol. Its IUPAC name is N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-N-ethyl-2,2,2-trifluoroethanamine.
| Compound Name | N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-N-ethyl-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 66469817 |
| Molecular Formula | C14H25F3N2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-N-ethyl-2,2,2-trifluoroethanamine |
| SMILES | CCN(CC1CCC2CCCCC2N1)CC(F)(F)F |
| InChI | InChI=1S/C14H25F3N2/c1-2-19(10-14(15,16)17)9-12-8-7-11-5-3-4-6-13(11)18-12/h11-13,18H,2-10H2,1H3 |
| InChIKey | NVAPPENVVVWNEB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |