About 1-(1-chloroethyl)-2,4-dimethylcyclohexane
1-(1-chloroethyl)-2,4-dimethylcyclohexane (PubChem CID 66469845) has the molecular formula C10H19Cl
and a molecular weight of 174.72 g/mol. Its IUPAC name is 1-(1-chloroethyl)-2,4-dimethylcyclohexane.
Molecular Properties
| Compound Name | 1-(1-chloroethyl)-2,4-dimethylcyclohexane |
| PubChem CID | 66469845 |
| Molecular Formula | C10H19Cl |
| Molecular Weight | 174.72 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1-(1-chloroethyl)-2,4-dimethylcyclohexane |
| SMILES | CC1CCC(C(C)Cl)C(C)C1 |
| InChI | InChI=1S/C10H19Cl/c1-7-4-5-10(9(3)11)8(2)6-7/h7-10H,4-6H2,1-3H3 |
| InChIKey | ULYQAMBYBDROMP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.72 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-chloroethyl)-2,4-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-chloroethyl)-2,4-dimethylcyclohexane?
The IUPAC name of 1-(1-chloroethyl)-2,4-dimethylcyclohexane (CID 66469845) is 1-(1-chloroethyl)-2,4-dimethylcyclohexane.
What is the SMILES notation for 1-(1-chloroethyl)-2,4-dimethylcyclohexane?
The canonical SMILES for 1-(1-chloroethyl)-2,4-dimethylcyclohexane is CC1CCC(C(C)Cl)C(C)C1.
What is the InChIKey of 1-(1-chloroethyl)-2,4-dimethylcyclohexane?
The InChIKey is ULYQAMBYBDROMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19Cl/c1-7-4-5-10(9(3)11)8(2)6-7/h7-10H,4-6H2,1-3H3.
What are the key properties of 1-(1-chloroethyl)-2,4-dimethylcyclohexane?
1-(1-chloroethyl)-2,4-dimethylcyclohexane has a molecular weight of 174.72 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-chloroethyl)-2,4-dimethylcyclohexane is sourced from PubChem (CID 66469845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).