C16H27N3S — CID 66470237
N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-1-(4-methyl-1,3-thiazol-2-yl)ethanamine (PubChem CID 66470237) has the molecular formula C16H27N3S and a molecular weight of 293.48 g/mol. Its IUPAC name is N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-1-(4-methyl-1,3-thiazol-2-yl)ethanamine.
| Compound Name | N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-1-(4-methyl-1,3-thiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 66470237 |
| Molecular Formula | C16H27N3S |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-1-(4-methyl-1,3-thiazol-2-yl)ethanamine |
| SMILES | Cc1csc(C(C)NCC2CCC3CCCCC3N2)n1 |
| InChI | InChI=1S/C16H27N3S/c1-11-10-20-16(18-11)12(2)17-9-14-8-7-13-5-3-4-6-15(13)19-14/h10,12-15,17,19H,3-9H2,1-2H3 |
| InChIKey | UMSYDWYPASUFEZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |