C18H36N2 — CID 66470624
N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-2,4,4-trimethylpentan-2-amine (PubChem CID 66470624) has the molecular formula C18H36N2 and a molecular weight of 280.50 g/mol. Its IUPAC name is N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-2,4,4-trimethylpentan-2-amine.
| Compound Name | N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-2,4,4-trimethylpentan-2-amine |
|---|---|
| PubChem CID | 66470624 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-2,4,4-trimethylpentan-2-amine |
| SMILES | CC(C)(C)CC(C)(C)NCC1CCC2CCCCC2N1 |
| InChI | InChI=1S/C18H36N2/c1-17(2,3)13-18(4,5)19-12-15-11-10-14-8-6-7-9-16(14)20-15/h14-16,19-20H,6-13H2,1-5H3 |
| InChIKey | IVFRPUDSMYRKJK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |