About 4-(1-bromopropan-2-yl)-1,3-dimethylpyrazole
4-(1-bromopropan-2-yl)-1,3-dimethylpyrazole (PubChem CID 66470862) has the molecular formula C8H13BrN2
and a molecular weight of 217.11 g/mol. Its IUPAC name is 4-(1-bromopropan-2-yl)-1,3-dimethylpyrazole.
Molecular Properties
| Compound Name | 4-(1-bromopropan-2-yl)-1,3-dimethylpyrazole |
| PubChem CID | 66470862 |
| Molecular Formula | C8H13BrN2 |
| Molecular Weight | 217.11 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 4-(1-bromopropan-2-yl)-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)cc1C(C)CBr |
| InChI | InChI=1S/C8H13BrN2/c1-6(4-9)8-5-11(3)10-7(8)2/h5-6H,4H2,1-3H3 |
| InChIKey | OWNNQRPOLDWOIP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.11 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-bromopropan-2-yl)-1,3-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-bromopropan-2-yl)-1,3-dimethylpyrazole?
The IUPAC name of 4-(1-bromopropan-2-yl)-1,3-dimethylpyrazole (CID 66470862) is 4-(1-bromopropan-2-yl)-1,3-dimethylpyrazole.
What is the SMILES notation for 4-(1-bromopropan-2-yl)-1,3-dimethylpyrazole?
The canonical SMILES for 4-(1-bromopropan-2-yl)-1,3-dimethylpyrazole is Cc1nn(C)cc1C(C)CBr.
What is the InChIKey of 4-(1-bromopropan-2-yl)-1,3-dimethylpyrazole?
The InChIKey is OWNNQRPOLDWOIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13BrN2/c1-6(4-9)8-5-11(3)10-7(8)2/h5-6H,4H2,1-3H3.
What are the key properties of 4-(1-bromopropan-2-yl)-1,3-dimethylpyrazole?
4-(1-bromopropan-2-yl)-1,3-dimethylpyrazole has a molecular weight of 217.11 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-bromopropan-2-yl)-1,3-dimethylpyrazole is sourced from PubChem (CID 66470862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).