C16H27NO3 — CID 66470882
1-hexanoyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxylic acid (PubChem CID 66470882) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-hexanoyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxylic acid.
| Compound Name | 1-hexanoyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 66470882 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 1-hexanoyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxylic acid |
| SMILES | CCCCCC(=O)N1C(C(=O)O)CCC2CCCCC21 |
| InChI | InChI=1S/C16H27NO3/c1-2-3-4-9-15(18)17-13-8-6-5-7-12(13)10-11-14(17)16(19)20/h12-14H,2-11H2,1H3,(H,19,20) |
| InChIKey | CSUQHVMEZBYZJV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|