About 4-[2-(1,3-dioxan-2-yl)ethyl]-2,6-dimethylthiomorpholine
4-[2-(1,3-dioxan-2-yl)ethyl]-2,6-dimethylthiomorpholine (PubChem CID 66472120) has the molecular formula C12H23NO2S
and a molecular weight of 245.39 g/mol. Its IUPAC name is 4-[2-(1,3-dioxan-2-yl)ethyl]-2,6-dimethylthiomorpholine.
Molecular Properties
| Compound Name | 4-[2-(1,3-dioxan-2-yl)ethyl]-2,6-dimethylthiomorpholine |
| PubChem CID | 66472120 |
| Molecular Formula | C12H23NO2S |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 4-[2-(1,3-dioxan-2-yl)ethyl]-2,6-dimethylthiomorpholine |
| SMILES | CC1CN(CCC2OCCCO2)CC(C)S1 |
| InChI | InChI=1S/C12H23NO2S/c1-10-8-13(9-11(2)16-10)5-4-12-14-6-3-7-15-12/h10-12H,3-9H2,1-2H3 |
| InChIKey | KKKNDGNPEFIGEL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(1,3-dioxan-2-yl)ethyl]-2,6-dimethylthiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1,3-dioxan-2-yl)ethyl]-2,6-dimethylthiomorpholine?
The IUPAC name of 4-[2-(1,3-dioxan-2-yl)ethyl]-2,6-dimethylthiomorpholine (CID 66472120) is 4-[2-(1,3-dioxan-2-yl)ethyl]-2,6-dimethylthiomorpholine.
What is the SMILES notation for 4-[2-(1,3-dioxan-2-yl)ethyl]-2,6-dimethylthiomorpholine?
The canonical SMILES for 4-[2-(1,3-dioxan-2-yl)ethyl]-2,6-dimethylthiomorpholine is CC1CN(CCC2OCCCO2)CC(C)S1.
What is the InChIKey of 4-[2-(1,3-dioxan-2-yl)ethyl]-2,6-dimethylthiomorpholine?
The InChIKey is KKKNDGNPEFIGEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2S/c1-10-8-13(9-11(2)16-10)5-4-12-14-6-3-7-15-12/h10-12H,3-9H2,1-2H3.
What are the key properties of 4-[2-(1,3-dioxan-2-yl)ethyl]-2,6-dimethylthiomorpholine?
4-[2-(1,3-dioxan-2-yl)ethyl]-2,6-dimethylthiomorpholine has a molecular weight of 245.39 g/mol, XLogP of 1.97, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,3-dioxan-2-yl)ethyl]-2,6-dimethylthiomorpholine is sourced from PubChem (CID 66472120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).