About N,N-bis(cyclopropylmethyl)-2-(1,3-dioxan-2-yl)ethanamine
N,N-bis(cyclopropylmethyl)-2-(1,3-dioxan-2-yl)ethanamine (PubChem CID 66472122) has the molecular formula C14H25NO2
and a molecular weight of 239.36 g/mol. Its IUPAC name is N,N-bis(cyclopropylmethyl)-2-(1,3-dioxan-2-yl)ethanamine.
Molecular Properties
| Compound Name | N,N-bis(cyclopropylmethyl)-2-(1,3-dioxan-2-yl)ethanamine |
| PubChem CID | 66472122 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | N,N-bis(cyclopropylmethyl)-2-(1,3-dioxan-2-yl)ethanamine |
| SMILES | C1COC(CCN(CC2CC2)CC2CC2)OC1 |
| InChI | InChI=1S/C14H25NO2/c1-8-16-14(17-9-1)6-7-15(10-12-2-3-12)11-13-4-5-13/h12-14H,1-11H2 |
| InChIKey | PQUKIRJZIFLUIJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-bis(cyclopropylmethyl)-2-(1,3-dioxan-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(cyclopropylmethyl)-2-(1,3-dioxan-2-yl)ethanamine?
The IUPAC name of N,N-bis(cyclopropylmethyl)-2-(1,3-dioxan-2-yl)ethanamine (CID 66472122) is N,N-bis(cyclopropylmethyl)-2-(1,3-dioxan-2-yl)ethanamine.
What is the SMILES notation for N,N-bis(cyclopropylmethyl)-2-(1,3-dioxan-2-yl)ethanamine?
The canonical SMILES for N,N-bis(cyclopropylmethyl)-2-(1,3-dioxan-2-yl)ethanamine is C1COC(CCN(CC2CC2)CC2CC2)OC1.
What is the InChIKey of N,N-bis(cyclopropylmethyl)-2-(1,3-dioxan-2-yl)ethanamine?
The InChIKey is PQUKIRJZIFLUIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO2/c1-8-16-14(17-9-1)6-7-15(10-12-2-3-12)11-13-4-5-13/h12-14H,1-11H2.
What are the key properties of N,N-bis(cyclopropylmethyl)-2-(1,3-dioxan-2-yl)ethanamine?
N,N-bis(cyclopropylmethyl)-2-(1,3-dioxan-2-yl)ethanamine has a molecular weight of 239.36 g/mol, XLogP of 2.26, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(cyclopropylmethyl)-2-(1,3-dioxan-2-yl)ethanamine is sourced from PubChem (CID 66472122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).