C14H20BrNO2 — CID 66472399
methyl (2S)-2-[(4-bromo-3-methylphenyl)methylamino]-3-methylbutanoate (PubChem CID 66472399) has the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. Its IUPAC name is methyl (2S)-2-[(4-bromo-3-methylphenyl)methylamino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[(4-bromo-3-methylphenyl)methylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 66472399 |
| Molecular Formula | C14H20BrNO2 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | methyl (2S)-2-[(4-bromo-3-methylphenyl)methylamino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NCc1ccc(Br)c(C)c1)C(C)C |
| InChI | InChI=1S/C14H20BrNO2/c1-9(2)13(14(17)18-4)16-8-11-5-6-12(15)10(3)7-11/h5-7,9,13,16H,8H2,1-4H3/t13-/m0/s1 |
| InChIKey | NTICHKQJGTYJKD-ZDUSSCGKSA-N |
| XLogP | 3.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |