C11H20O4 — CID 66472549
2-[2-(oxolan-3-ylmethoxy)ethyl]-1,3-dioxane (PubChem CID 66472549) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-[2-(oxolan-3-ylmethoxy)ethyl]-1,3-dioxane.
| Compound Name | 2-[2-(oxolan-3-ylmethoxy)ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 66472549 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 2-[2-(oxolan-3-ylmethoxy)ethyl]-1,3-dioxane |
| SMILES | C1COC(CCOCC2CCOC2)OC1 |
| InChI | InChI=1S/C11H20O4/c1-4-14-11(15-5-1)3-7-13-9-10-2-6-12-8-10/h10-11H,1-9H2 |
| InChIKey | YKHOZCBRVIBSNT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|