About 2-[2-(3,4-difluorophenyl)sulfonylethyl]-1,3-dioxane
2-[2-(3,4-difluorophenyl)sulfonylethyl]-1,3-dioxane (PubChem CID 66472567) has the molecular formula C12H14F2O4S
and a molecular weight of 292.30 g/mol. Its IUPAC name is 2-[2-(3,4-difluorophenyl)sulfonylethyl]-1,3-dioxane.
Molecular Properties
| Compound Name | 2-[2-(3,4-difluorophenyl)sulfonylethyl]-1,3-dioxane |
| PubChem CID | 66472567 |
| Molecular Formula | C12H14F2O4S |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-[2-(3,4-difluorophenyl)sulfonylethyl]-1,3-dioxane |
| SMILES | O=S(=O)(CCC1OCCCO1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H14F2O4S/c13-10-3-2-9(8-11(10)14)19(15,16)7-4-12-17-5-1-6-18-12/h2-3,8,12H,1,4-7H2 |
| InChIKey | LFPNXZBPKYQDIV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(3,4-difluorophenyl)sulfonylethyl]-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,4-difluorophenyl)sulfonylethyl]-1,3-dioxane?
The IUPAC name of 2-[2-(3,4-difluorophenyl)sulfonylethyl]-1,3-dioxane (CID 66472567) is 2-[2-(3,4-difluorophenyl)sulfonylethyl]-1,3-dioxane.
What is the SMILES notation for 2-[2-(3,4-difluorophenyl)sulfonylethyl]-1,3-dioxane?
The canonical SMILES for 2-[2-(3,4-difluorophenyl)sulfonylethyl]-1,3-dioxane is O=S(=O)(CCC1OCCCO1)c1ccc(F)c(F)c1.
What is the InChIKey of 2-[2-(3,4-difluorophenyl)sulfonylethyl]-1,3-dioxane?
The InChIKey is LFPNXZBPKYQDIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2O4S/c13-10-3-2-9(8-11(10)14)19(15,16)7-4-12-17-5-1-6-18-12/h2-3,8,12H,1,4-7H2.
What are the key properties of 2-[2-(3,4-difluorophenyl)sulfonylethyl]-1,3-dioxane?
2-[2-(3,4-difluorophenyl)sulfonylethyl]-1,3-dioxane has a molecular weight of 292.30 g/mol, XLogP of 1.89, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,4-difluorophenyl)sulfonylethyl]-1,3-dioxane is sourced from PubChem (CID 66472567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).