C14H20O3S — CID 66472570
2-[2-(2,4-dimethylphenyl)sulfinylethyl]-1,3-dioxane (PubChem CID 66472570) has the molecular formula C14H20O3S and a molecular weight of 268.38 g/mol. Its IUPAC name is 2-[2-(2,4-dimethylphenyl)sulfinylethyl]-1,3-dioxane.
| Compound Name | 2-[2-(2,4-dimethylphenyl)sulfinylethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 66472570 |
| Molecular Formula | C14H20O3S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-[2-(2,4-dimethylphenyl)sulfinylethyl]-1,3-dioxane |
| SMILES | Cc1ccc(S(=O)CCC2OCCCO2)c(C)c1 |
| InChI | InChI=1S/C14H20O3S/c1-11-4-5-13(12(2)10-11)18(15)9-6-14-16-7-3-8-17-14/h4-5,10,14H,3,6-9H2,1-2H3 |
| InChIKey | HQGLWARSDBWASV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |