C14H28N2O2 — CID 66472718
N-[2-(1,3-dioxan-2-yl)ethyl]-N-propylpiperidin-4-amine (PubChem CID 66472718) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is N-[2-(1,3-dioxan-2-yl)ethyl]-N-propylpiperidin-4-amine.
| Compound Name | N-[2-(1,3-dioxan-2-yl)ethyl]-N-propylpiperidin-4-amine |
|---|---|
| PubChem CID | 66472718 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | N-[2-(1,3-dioxan-2-yl)ethyl]-N-propylpiperidin-4-amine |
| SMILES | CCCN(CCC1OCCCO1)C1CCNCC1 |
| InChI | InChI=1S/C14H28N2O2/c1-2-9-16(13-4-7-15-8-5-13)10-6-14-17-11-3-12-18-14/h13-15H,2-12H2,1H3 |
| InChIKey | LIJVFDQCSDTUTO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |