About 3-[2-(1,3-dioxan-2-yl)ethyl]-1-ethyl-5-nitropyrimidine-2,4-dione
3-[2-(1,3-dioxan-2-yl)ethyl]-1-ethyl-5-nitropyrimidine-2,4-dione (PubChem CID 66472937) has the molecular formula C12H17N3O6
and a molecular weight of 299.28 g/mol. Its IUPAC name is 3-[2-(1,3-dioxan-2-yl)ethyl]-1-ethyl-5-nitropyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 3-[2-(1,3-dioxan-2-yl)ethyl]-1-ethyl-5-nitropyrimidine-2,4-dione |
| PubChem CID | 66472937 |
| Molecular Formula | C12H17N3O6 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 3-[2-(1,3-dioxan-2-yl)ethyl]-1-ethyl-5-nitropyrimidine-2,4-dione |
| SMILES | CCn1cc([N+](=O)[O-])c(=O)n(CCC2OCCCO2)c1=O |
| InChI | InChI=1S/C12H17N3O6/c1-2-13-8-9(15(18)19)11(16)14(12(13)17)5-4-10-20-6-3-7-21-10/h8,10H,2-7H2,1H3 |
| InChIKey | IUOTWPFRAKEWFI-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 105.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(1,3-dioxan-2-yl)ethyl]-1-ethyl-5-nitropyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(1,3-dioxan-2-yl)ethyl]-1-ethyl-5-nitropyrimidine-2,4-dione?
The IUPAC name of 3-[2-(1,3-dioxan-2-yl)ethyl]-1-ethyl-5-nitropyrimidine-2,4-dione (CID 66472937) is 3-[2-(1,3-dioxan-2-yl)ethyl]-1-ethyl-5-nitropyrimidine-2,4-dione.
What is the SMILES notation for 3-[2-(1,3-dioxan-2-yl)ethyl]-1-ethyl-5-nitropyrimidine-2,4-dione?
The canonical SMILES for 3-[2-(1,3-dioxan-2-yl)ethyl]-1-ethyl-5-nitropyrimidine-2,4-dione is CCn1cc([N+](=O)[O-])c(=O)n(CCC2OCCCO2)c1=O.
What is the InChIKey of 3-[2-(1,3-dioxan-2-yl)ethyl]-1-ethyl-5-nitropyrimidine-2,4-dione?
The InChIKey is IUOTWPFRAKEWFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O6/c1-2-13-8-9(15(18)19)11(16)14(12(13)17)5-4-10-20-6-3-7-21-10/h8,10H,2-7H2,1H3.
What are the key properties of 3-[2-(1,3-dioxan-2-yl)ethyl]-1-ethyl-5-nitropyrimidine-2,4-dione?
3-[2-(1,3-dioxan-2-yl)ethyl]-1-ethyl-5-nitropyrimidine-2,4-dione has a molecular weight of 299.28 g/mol, XLogP of 0.09, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1,3-dioxan-2-yl)ethyl]-1-ethyl-5-nitropyrimidine-2,4-dione is sourced from PubChem (CID 66472937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).