About 1-[2-(1,3-dioxan-2-yl)ethyl]-N,N-dimethylpiperidin-3-amine
1-[2-(1,3-dioxan-2-yl)ethyl]-N,N-dimethylpiperidin-3-amine (PubChem CID 66473733) has the molecular formula C13H26N2O2
and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-[2-(1,3-dioxan-2-yl)ethyl]-N,N-dimethylpiperidin-3-amine.
Molecular Properties
| Compound Name | 1-[2-(1,3-dioxan-2-yl)ethyl]-N,N-dimethylpiperidin-3-amine |
| PubChem CID | 66473733 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1-[2-(1,3-dioxan-2-yl)ethyl]-N,N-dimethylpiperidin-3-amine |
| SMILES | CN(C)C1CCCN(CCC2OCCCO2)C1 |
| InChI | InChI=1S/C13H26N2O2/c1-14(2)12-5-3-7-15(11-12)8-6-13-16-9-4-10-17-13/h12-13H,3-11H2,1-2H3 |
| InChIKey | FHHUFPSJBSZUGN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(1,3-dioxan-2-yl)ethyl]-N,N-dimethylpiperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1,3-dioxan-2-yl)ethyl]-N,N-dimethylpiperidin-3-amine?
The IUPAC name of 1-[2-(1,3-dioxan-2-yl)ethyl]-N,N-dimethylpiperidin-3-amine (CID 66473733) is 1-[2-(1,3-dioxan-2-yl)ethyl]-N,N-dimethylpiperidin-3-amine.
What is the SMILES notation for 1-[2-(1,3-dioxan-2-yl)ethyl]-N,N-dimethylpiperidin-3-amine?
The canonical SMILES for 1-[2-(1,3-dioxan-2-yl)ethyl]-N,N-dimethylpiperidin-3-amine is CN(C)C1CCCN(CCC2OCCCO2)C1.
What is the InChIKey of 1-[2-(1,3-dioxan-2-yl)ethyl]-N,N-dimethylpiperidin-3-amine?
The InChIKey is FHHUFPSJBSZUGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O2/c1-14(2)12-5-3-7-15(11-12)8-6-13-16-9-4-10-17-13/h12-13H,3-11H2,1-2H3.
What are the key properties of 1-[2-(1,3-dioxan-2-yl)ethyl]-N,N-dimethylpiperidin-3-amine?
1-[2-(1,3-dioxan-2-yl)ethyl]-N,N-dimethylpiperidin-3-amine has a molecular weight of 242.36 g/mol, XLogP of 1.17, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1,3-dioxan-2-yl)ethyl]-N,N-dimethylpiperidin-3-amine is sourced from PubChem (CID 66473733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).