About 2-[2-(benzenesulfonyl)ethyl]-1,3-dioxane
2-[2-(benzenesulfonyl)ethyl]-1,3-dioxane (PubChem CID 66474369) has the molecular formula C12H16O4S
and a molecular weight of 256.32 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)ethyl]-1,3-dioxane.
Molecular Properties
| Compound Name | 2-[2-(benzenesulfonyl)ethyl]-1,3-dioxane |
| PubChem CID | 66474369 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-[2-(benzenesulfonyl)ethyl]-1,3-dioxane |
| SMILES | O=S(=O)(CCC1OCCCO1)c1ccccc1 |
| InChI | InChI=1S/C12H16O4S/c13-17(14,11-5-2-1-3-6-11)10-7-12-15-8-4-9-16-12/h1-3,5-6,12H,4,7-10H2 |
| InChIKey | QZESVRRHZVZHMD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(benzenesulfonyl)ethyl]-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(benzenesulfonyl)ethyl]-1,3-dioxane?
The IUPAC name of 2-[2-(benzenesulfonyl)ethyl]-1,3-dioxane (CID 66474369) is 2-[2-(benzenesulfonyl)ethyl]-1,3-dioxane.
What is the SMILES notation for 2-[2-(benzenesulfonyl)ethyl]-1,3-dioxane?
The canonical SMILES for 2-[2-(benzenesulfonyl)ethyl]-1,3-dioxane is O=S(=O)(CCC1OCCCO1)c1ccccc1.
What is the InChIKey of 2-[2-(benzenesulfonyl)ethyl]-1,3-dioxane?
The InChIKey is QZESVRRHZVZHMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O4S/c13-17(14,11-5-2-1-3-6-11)10-7-12-15-8-4-9-16-12/h1-3,5-6,12H,4,7-10H2.
What are the key properties of 2-[2-(benzenesulfonyl)ethyl]-1,3-dioxane?
2-[2-(benzenesulfonyl)ethyl]-1,3-dioxane has a molecular weight of 256.32 g/mol, XLogP of 1.61, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(benzenesulfonyl)ethyl]-1,3-dioxane is sourced from PubChem (CID 66474369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).