About 5-bromo-3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one
5-bromo-3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one (PubChem CID 66474955) has the molecular formula C10H13BrN2O3
and a molecular weight of 289.13 g/mol. Its IUPAC name is 5-bromo-3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-bromo-3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one |
| PubChem CID | 66474955 |
| Molecular Formula | C10H13BrN2O3 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 5-bromo-3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one |
| SMILES | O=c1c(Br)cncn1CCC1OCCCO1 |
| InChI | InChI=1S/C10H13BrN2O3/c11-8-6-12-7-13(10(8)14)3-2-9-15-4-1-5-16-9/h6-7,9H,1-5H2 |
| InChIKey | ISHZYVKHCTZDBI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one?
The IUPAC name of 5-bromo-3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one (CID 66474955) is 5-bromo-3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one.
What is the SMILES notation for 5-bromo-3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one?
The canonical SMILES for 5-bromo-3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one is O=c1c(Br)cncn1CCC1OCCCO1.
What is the InChIKey of 5-bromo-3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one?
The InChIKey is ISHZYVKHCTZDBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrN2O3/c11-8-6-12-7-13(10(8)14)3-2-9-15-4-1-5-16-9/h6-7,9H,1-5H2.
What are the key properties of 5-bromo-3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one?
5-bromo-3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one has a molecular weight of 289.13 g/mol, XLogP of 1.16, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one is sourced from PubChem (CID 66474955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).