C18H23BrN2 — CID 66475010
1-N-[(4-bromo-3-methylphenyl)methyl]-4-N,4-N-diethylbenzene-1,4-diamine (PubChem CID 66475010) has the molecular formula C18H23BrN2 and a molecular weight of 347.30 g/mol. Its IUPAC name is 1-N-[(4-bromo-3-methylphenyl)methyl]-4-N,4-N-diethylbenzene-1,4-diamine.
| Compound Name | 1-N-[(4-bromo-3-methylphenyl)methyl]-4-N,4-N-diethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 66475010 |
| Molecular Formula | C18H23BrN2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1-N-[(4-bromo-3-methylphenyl)methyl]-4-N,4-N-diethylbenzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(NCc2ccc(Br)c(C)c2)cc1 |
| InChI | InChI=1S/C18H23BrN2/c1-4-21(5-2)17-9-7-16(8-10-17)20-13-15-6-11-18(19)14(3)12-15/h6-12,20H,4-5,13H2,1-3H3 |
| InChIKey | ZHWNRKBYELMCCC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|