About 2-[2-(2,4-difluorophenyl)sulfanylethyl]-1,3-dioxane
2-[2-(2,4-difluorophenyl)sulfanylethyl]-1,3-dioxane (PubChem CID 66475176) has the molecular formula C12H14F2O2S
and a molecular weight of 260.30 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)sulfanylethyl]-1,3-dioxane.
Molecular Properties
| Compound Name | 2-[2-(2,4-difluorophenyl)sulfanylethyl]-1,3-dioxane |
| PubChem CID | 66475176 |
| Molecular Formula | C12H14F2O2S |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 2-[2-(2,4-difluorophenyl)sulfanylethyl]-1,3-dioxane |
| SMILES | Fc1ccc(SCCC2OCCCO2)c(F)c1 |
| InChI | InChI=1S/C12H14F2O2S/c13-9-2-3-11(10(14)8-9)17-7-4-12-15-5-1-6-16-12/h2-3,8,12H,1,4-7H2 |
| InChIKey | REGORQHSIPQLNL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(2,4-difluorophenyl)sulfanylethyl]-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,4-difluorophenyl)sulfanylethyl]-1,3-dioxane?
The IUPAC name of 2-[2-(2,4-difluorophenyl)sulfanylethyl]-1,3-dioxane (CID 66475176) is 2-[2-(2,4-difluorophenyl)sulfanylethyl]-1,3-dioxane.
What is the SMILES notation for 2-[2-(2,4-difluorophenyl)sulfanylethyl]-1,3-dioxane?
The canonical SMILES for 2-[2-(2,4-difluorophenyl)sulfanylethyl]-1,3-dioxane is Fc1ccc(SCCC2OCCCO2)c(F)c1.
What is the InChIKey of 2-[2-(2,4-difluorophenyl)sulfanylethyl]-1,3-dioxane?
The InChIKey is REGORQHSIPQLNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2O2S/c13-9-2-3-11(10(14)8-9)17-7-4-12-15-5-1-6-16-12/h2-3,8,12H,1,4-7H2.
What are the key properties of 2-[2-(2,4-difluorophenyl)sulfanylethyl]-1,3-dioxane?
2-[2-(2,4-difluorophenyl)sulfanylethyl]-1,3-dioxane has a molecular weight of 260.30 g/mol, XLogP of 3.21, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,4-difluorophenyl)sulfanylethyl]-1,3-dioxane is sourced from PubChem (CID 66475176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).