C10H17N3 — CID 66475759
5-(2,2,3,3-tetramethylcyclopropyl)-1H-pyrazol-3-amine (PubChem CID 66475759) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 5-(2,2,3,3-tetramethylcyclopropyl)-1H-pyrazol-3-amine.
| Compound Name | 5-(2,2,3,3-tetramethylcyclopropyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 66475759 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 5-(2,2,3,3-tetramethylcyclopropyl)-1H-pyrazol-3-amine |
| SMILES | CC1(C)C(c2cc(N)n[nH]2)C1(C)C |
| InChI | InChI=1S/C10H17N3/c1-9(2)8(10(9,3)4)6-5-7(11)13-12-6/h5,8H,1-4H3,(H3,11,12,13) |
| InChIKey | OCZKDXGUCKTOFF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |