C20H31Cl — CID 66475812
1-[chloro-(2,2,3,3-tetramethylcyclopropyl)methyl]-2,4-di(propan-2-yl)benzene (PubChem CID 66475812) has the molecular formula C20H31Cl and a molecular weight of 306.92 g/mol. Its IUPAC name is 1-[chloro-(2,2,3,3-tetramethylcyclopropyl)methyl]-2,4-di(propan-2-yl)benzene.
| Compound Name | 1-[chloro-(2,2,3,3-tetramethylcyclopropyl)methyl]-2,4-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 66475812 |
| Molecular Formula | C20H31Cl |
| Molecular Weight | 306.92 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 1-[chloro-(2,2,3,3-tetramethylcyclopropyl)methyl]-2,4-di(propan-2-yl)benzene |
| SMILES | CC(C)c1ccc(C(Cl)C2C(C)(C)C2(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C20H31Cl/c1-12(2)14-9-10-15(16(11-14)13(3)4)17(21)18-19(5,6)20(18,7)8/h9-13,17-18H,1-8H3 |
| InChIKey | PNRQKZDRXRGAAR-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.92 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|