C11H19NO — CID 66476353
2,2,3,3-tetramethyl-N-prop-2-enylcyclopropane-1-carboxamide (PubChem CID 66476353) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-N-prop-2-enylcyclopropane-1-carboxamide.
| Compound Name | 2,2,3,3-tetramethyl-N-prop-2-enylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 66476353 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 2,2,3,3-tetramethyl-N-prop-2-enylcyclopropane-1-carboxamide |
| SMILES | C=CCNC(=O)C1C(C)(C)C1(C)C |
| InChI | InChI=1S/C11H19NO/c1-6-7-12-9(13)8-10(2,3)11(8,4)5/h6,8H,1,7H2,2-5H3,(H,12,13) |
| InChIKey | DKCZLPGXUUYINT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|