C15H24N2O3 — CID 66476374
3,3-dimethyl-4-[5-(2,2,3,3-tetramethylcyclopropyl)-1,3,4-oxadiazol-2-yl]butanoic acid (PubChem CID 66476374) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 3,3-dimethyl-4-[5-(2,2,3,3-tetramethylcyclopropyl)-1,3,4-oxadiazol-2-yl]butanoic acid.
| Compound Name | 3,3-dimethyl-4-[5-(2,2,3,3-tetramethylcyclopropyl)-1,3,4-oxadiazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 66476374 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 3,3-dimethyl-4-[5-(2,2,3,3-tetramethylcyclopropyl)-1,3,4-oxadiazol-2-yl]butanoic acid |
| SMILES | CC(C)(CC(=O)O)Cc1nnc(C2C(C)(C)C2(C)C)o1 |
| InChI | InChI=1S/C15H24N2O3/c1-13(2,8-10(18)19)7-9-16-17-12(20-9)11-14(3,4)15(11,5)6/h11H,7-8H2,1-6H3,(H,18,19) |
| InChIKey | AMZPYFCTUSJVJT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |