C12H12BrN3 — CID 66479676
2-(4-bromo-3-methylphenyl)-6-methylpyrimidin-4-amine (PubChem CID 66479676) has the molecular formula C12H12BrN3 and a molecular weight of 278.15 g/mol. Its IUPAC name is 2-(4-bromo-3-methylphenyl)-6-methylpyrimidin-4-amine.
| Compound Name | 2-(4-bromo-3-methylphenyl)-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66479676 |
| Molecular Formula | C12H12BrN3 |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 2-(4-bromo-3-methylphenyl)-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(N)nc(-c2ccc(Br)c(C)c2)n1 |
| InChI | InChI=1S/C12H12BrN3/c1-7-5-9(3-4-10(7)13)12-15-8(2)6-11(14)16-12/h3-6H,1-2H3,(H2,14,15,16) |
| InChIKey | KLRQEEFQUFDEOK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |