C16H17F4N3O — CID 664813
4-[[4-(3,5-dimethylpyrazol-1-yl)-2,3,5,6-tetrafluorophenyl]methyl]morpholine (PubChem CID 664813) has the molecular formula C16H17F4N3O and a molecular weight of 343.32 g/mol. Its IUPAC name is 4-[[4-(3,5-dimethylpyrazol-1-yl)-2,3,5,6-tetrafluorophenyl]methyl]morpholine.
| Compound Name | 4-[[4-(3,5-dimethylpyrazol-1-yl)-2,3,5,6-tetrafluorophenyl]methyl]morpholine |
|---|---|
| PubChem CID | 664813 |
| Molecular Formula | C16H17F4N3O |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 4-[[4-(3,5-dimethylpyrazol-1-yl)-2,3,5,6-tetrafluorophenyl]methyl]morpholine |
| SMILES | Cc1cc(C)n(-c2c(F)c(F)c(CN3CCOCC3)c(F)c2F)n1 |
| InChI | InChI=1S/C16H17F4N3O/c1-9-7-10(2)23(21-9)16-14(19)12(17)11(13(18)15(16)20)8-22-3-5-24-6-4-22/h7H,3-6,8H2,1-2H3 |
| InChIKey | ZQKGIYNJEZKESL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|