C14H18N2O2 — CID 66484764
N,N-diethyl-3-(4-hydroxybut-1-ynyl)pyridine-4-carboxamide (PubChem CID 66484764) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is N,N-diethyl-3-(4-hydroxybut-1-ynyl)pyridine-4-carboxamide.
| Compound Name | N,N-diethyl-3-(4-hydroxybut-1-ynyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 66484764 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | N,N-diethyl-3-(4-hydroxybut-1-ynyl)pyridine-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccncc1C#CCCO |
| InChI | InChI=1S/C14H18N2O2/c1-3-16(4-2)14(18)13-8-9-15-11-12(13)7-5-6-10-17/h8-9,11,17H,3-4,6,10H2,1-2H3 |
| InChIKey | NLDOLDDAGGNQPY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|