C11H11ClN4O — CID 66484932
3-chloro-N-(1H-imidazol-2-ylmethyl)-N-methylpyridine-4-carboxamide (PubChem CID 66484932) has the molecular formula C11H11ClN4O and a molecular weight of 250.69 g/mol. Its IUPAC name is 3-chloro-N-(1H-imidazol-2-ylmethyl)-N-methylpyridine-4-carboxamide.
| Compound Name | 3-chloro-N-(1H-imidazol-2-ylmethyl)-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 66484932 |
| Molecular Formula | C11H11ClN4O |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 3-chloro-N-(1H-imidazol-2-ylmethyl)-N-methylpyridine-4-carboxamide |
| SMILES | CN(Cc1ncc[nH]1)C(=O)c1ccncc1Cl |
| InChI | InChI=1S/C11H11ClN4O/c1-16(7-10-14-4-5-15-10)11(17)8-2-3-13-6-9(8)12/h2-6H,7H2,1H3,(H,14,15) |
| InChIKey | DSFWGILHVAEJHA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |