C15H10ClFN2O2 — CID 66484973
N-(2-chloro-4-fluorophenyl)-3-(3-hydroxyprop-1-ynyl)pyridine-4-carboxamide (PubChem CID 66484973) has the molecular formula C15H10ClFN2O2 and a molecular weight of 304.71 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-3-(3-hydroxyprop-1-ynyl)pyridine-4-carboxamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-3-(3-hydroxyprop-1-ynyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 66484973 |
| Molecular Formula | C15H10ClFN2O2 |
| Molecular Weight | 304.71 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-3-(3-hydroxyprop-1-ynyl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1Cl)c1ccncc1C#CCO |
| InChI | InChI=1S/C15H10ClFN2O2/c16-13-8-11(17)3-4-14(13)19-15(21)12-5-6-18-9-10(12)2-1-7-20/h3-6,8-9,20H,7H2,(H,19,21) |
| InChIKey | ZYJPYWNQWUAUAO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.71 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|