C11H17NO3S — CID 66485781
4-ethoxy-N,2,5-trimethylbenzenesulfonamide (PubChem CID 66485781) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is 4-ethoxy-N,2,5-trimethylbenzenesulfonamide.
| Compound Name | 4-ethoxy-N,2,5-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 66485781 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 4-ethoxy-N,2,5-trimethylbenzenesulfonamide |
| SMILES | CCOc1cc(C)c(S(=O)(=O)NC)cc1C |
| InChI | InChI=1S/C11H17NO3S/c1-5-15-10-6-9(3)11(7-8(10)2)16(13,14)12-4/h6-7,12H,5H2,1-4H3 |
| InChIKey | BKLKMGBHSUWAGB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |