About methyl (2S)-2-[(2,5-dimethylphenyl)carbamoylamino]-4-methylsulfanylbutanoate
methyl (2S)-2-[(2,5-dimethylphenyl)carbamoylamino]-4-methylsulfanylbutanoate (PubChem CID 664859) has the molecular formula C15H22N2O3S
and a molecular weight of 310.42 g/mol. Its IUPAC name is methyl (2S)-2-[(2,5-dimethylphenyl)carbamoylamino]-4-methylsulfanylbutanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[(2,5-dimethylphenyl)carbamoylamino]-4-methylsulfanylbutanoate |
| PubChem CID | 664859 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | methyl (2S)-2-[(2,5-dimethylphenyl)carbamoylamino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@H](CCSC)NC(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C15H22N2O3S/c1-10-5-6-11(2)13(9-10)17-15(19)16-12(7-8-21-4)14(18)20-3/h5-6,9,12H,7-8H2,1-4H3,(H2,16,17,19)/t12-/m0/s1 |
| InChIKey | JFWDPHOIKWYTHA-LBPRGKRZSA-N |
| XLogP | 2.72 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2S)-2-[(2,5-dimethylphenyl)carbamoylamino]-4-methylsulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[(2,5-dimethylphenyl)carbamoylamino]-4-methylsulfanylbutanoate?
The IUPAC name of methyl (2S)-2-[(2,5-dimethylphenyl)carbamoylamino]-4-methylsulfanylbutanoate (CID 664859) is methyl (2S)-2-[(2,5-dimethylphenyl)carbamoylamino]-4-methylsulfanylbutanoate.
What is the SMILES notation for methyl (2S)-2-[(2,5-dimethylphenyl)carbamoylamino]-4-methylsulfanylbutanoate?
The canonical SMILES for methyl (2S)-2-[(2,5-dimethylphenyl)carbamoylamino]-4-methylsulfanylbutanoate is COC(=O)[C@H](CCSC)NC(=O)Nc1cc(C)ccc1C.
What is the InChIKey of methyl (2S)-2-[(2,5-dimethylphenyl)carbamoylamino]-4-methylsulfanylbutanoate?
The InChIKey is JFWDPHOIKWYTHA-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H22N2O3S/c1-10-5-6-11(2)13(9-10)17-15(19)16-12(7-8-21-4)14(18)20-3/h5-6,9,12H,7-8H2,1-4H3,(H2,16,17,19)/t12-/m0/s1.
What are the key properties of methyl (2S)-2-[(2,5-dimethylphenyl)carbamoylamino]-4-methylsulfanylbutanoate?
methyl (2S)-2-[(2,5-dimethylphenyl)carbamoylamino]-4-methylsulfanylbutanoate has a molecular weight of 310.42 g/mol, XLogP of 2.72, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[(2,5-dimethylphenyl)carbamoylamino]-4-methylsulfanylbutanoate is sourced from PubChem (CID 664859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).