About 2-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-oxazol-5-amine
2-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-oxazol-5-amine (PubChem CID 66486222) has the molecular formula C7H8N4O2
and a molecular weight of 180.17 g/mol. Its IUPAC name is 2-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-oxazol-5-amine.
Molecular Properties
| Compound Name | 2-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-oxazol-5-amine |
| PubChem CID | 66486222 |
| Molecular Formula | C7H8N4O2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 2-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-oxazol-5-amine |
| SMILES | Cc1nnc(-c2nc(C)oc2N)o1 |
| InChI | InChI=1S/C7H8N4O2/c1-3-9-5(6(8)12-3)7-11-10-4(2)13-7/h8H2,1-2H3 |
| InChIKey | KOAORHALPPJMNF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-oxazol-5-amine?
The IUPAC name of 2-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-oxazol-5-amine (CID 66486222) is 2-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-oxazol-5-amine.
What is the SMILES notation for 2-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-oxazol-5-amine?
The canonical SMILES for 2-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-oxazol-5-amine is Cc1nnc(-c2nc(C)oc2N)o1.
What is the InChIKey of 2-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-oxazol-5-amine?
The InChIKey is KOAORHALPPJMNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O2/c1-3-9-5(6(8)12-3)7-11-10-4(2)13-7/h8H2,1-2H3.
What are the key properties of 2-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-oxazol-5-amine?
2-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-oxazol-5-amine has a molecular weight of 180.17 g/mol, XLogP of 0.92, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-1,3-oxazol-5-amine is sourced from PubChem (CID 66486222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).