About 2-(4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethanol
2-(4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethanol (PubChem CID 66486328) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 2-(4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethanol.
Molecular Properties
| Compound Name | 2-(4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethanol |
| PubChem CID | 66486328 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 2-(4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethanol |
| SMILES | OCCN1CC2C3C=CC(C3)C2C1 |
| InChI | InChI=1S/C11H17NO/c13-4-3-12-6-10-8-1-2-9(5-8)11(10)7-12/h1-2,8-11,13H,3-7H2 |
| InChIKey | BTYQGWSDVJEPPT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethanol?
The IUPAC name of 2-(4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethanol (CID 66486328) is 2-(4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethanol.
What is the SMILES notation for 2-(4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethanol?
The canonical SMILES for 2-(4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethanol is OCCN1CC2C3C=CC(C3)C2C1.
What is the InChIKey of 2-(4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethanol?
The InChIKey is BTYQGWSDVJEPPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c13-4-3-12-6-10-8-1-2-9(5-8)11(10)7-12/h1-2,8-11,13H,3-7H2.
What are the key properties of 2-(4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethanol?
2-(4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethanol has a molecular weight of 179.26 g/mol, XLogP of 0.73, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethanol is sourced from PubChem (CID 66486328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).