About 4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-ene
4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 66486601) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is 4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-ene.
Molecular Properties
| Compound Name | 4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-ene |
| PubChem CID | 66486601 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | C=CCN1CC2C3C=CC(C3)C2C1 |
| InChI | InChI=1S/C12H17N/c1-2-5-13-7-11-9-3-4-10(6-9)12(11)8-13/h2-4,9-12H,1,5-8H2 |
| InChIKey | YIZHEOSIIXUGSV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-ene?
The IUPAC name of 4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-ene (CID 66486601) is 4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-ene.
What is the SMILES notation for 4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-ene?
The canonical SMILES for 4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-ene is C=CCN1CC2C3C=CC(C3)C2C1.
What is the InChIKey of 4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-ene?
The InChIKey is YIZHEOSIIXUGSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-2-5-13-7-11-9-3-4-10(6-9)12(11)8-13/h2-4,9-12H,1,5-8H2.
What are the key properties of 4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-ene?
4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-ene has a molecular weight of 175.27 g/mol, XLogP of 1.93, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-8-ene is sourced from PubChem (CID 66486601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).