C17H22N2 — CID 66486623
[4-(4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)phenyl]methanamine (PubChem CID 66486623) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is [4-(4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)phenyl]methanamine.
| Compound Name | [4-(4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 66486623 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | [4-(4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)phenyl]methanamine |
| SMILES | NCc1ccc(N2CC3C4C=CC(CC4)C3C2)cc1 |
| InChI | InChI=1S/C17H22N2/c18-9-12-1-7-15(8-2-12)19-10-16-13-3-4-14(6-5-13)17(16)11-19/h1-4,7-8,13-14,16-17H,5-6,9-11,18H2 |
| InChIKey | XIKYULBJJLXXRK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|