About 6,6-diethoxyhex-4-yn-3-ol
6,6-diethoxyhex-4-yn-3-ol (PubChem CID 66486760) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 6,6-diethoxyhex-4-yn-3-ol.
Molecular Properties
| Compound Name | 6,6-diethoxyhex-4-yn-3-ol |
| PubChem CID | 66486760 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 6,6-diethoxyhex-4-yn-3-ol |
| SMILES | CCOC(C#CC(O)CC)OCC |
| InChI | InChI=1S/C10H18O3/c1-4-9(11)7-8-10(12-5-2)13-6-3/h9-11H,4-6H2,1-3H3 |
| InChIKey | KMQZWLILQMKVEI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6,6-diethoxyhex-4-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-diethoxyhex-4-yn-3-ol?
The IUPAC name of 6,6-diethoxyhex-4-yn-3-ol (CID 66486760) is 6,6-diethoxyhex-4-yn-3-ol.
What is the SMILES notation for 6,6-diethoxyhex-4-yn-3-ol?
The canonical SMILES for 6,6-diethoxyhex-4-yn-3-ol is CCOC(C#CC(O)CC)OCC.
What is the InChIKey of 6,6-diethoxyhex-4-yn-3-ol?
The InChIKey is KMQZWLILQMKVEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-4-9(11)7-8-10(12-5-2)13-6-3/h9-11H,4-6H2,1-3H3.
What are the key properties of 6,6-diethoxyhex-4-yn-3-ol?
6,6-diethoxyhex-4-yn-3-ol has a molecular weight of 186.25 g/mol, XLogP of 1.16, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-diethoxyhex-4-yn-3-ol is sourced from PubChem (CID 66486760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).