C20H15ClN4O5S — CID 66488111
2-[2-[3-(4-chlorophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-oxo-1,3-thiazol-5-yl]acetic acid (PubChem CID 66488111) has the molecular formula C20H15ClN4O5S and a molecular weight of 458.88 g/mol. Its IUPAC name is 2-[2-[3-(4-chlorophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-oxo-1,3-thiazol-5-yl]acetic acid.
| Compound Name | 2-[2-[3-(4-chlorophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-oxo-1,3-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 66488111 |
| Molecular Formula | C20H15ClN4O5S |
| Molecular Weight | 458.88 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 2-[2-[3-(4-chlorophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-oxo-1,3-thiazol-5-yl]acetic acid |
| SMILES | O=C(O)CC1SC(N2N=C(c3ccc([N+](=O)[O-])cc3)CC2c2ccc(Cl)cc2)=NC1=O |
| InChI | InChI=1S/C20H15ClN4O5S/c21-13-5-1-12(2-6-13)16-9-15(11-3-7-14(8-4-11)25(29)30)23-24(16)20-22-19(28)17(31-20)10-18(26)27/h1-8,16-17H,9-10H2,(H,26,27) |
| InChIKey | JRURIJNKKHIJBL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.88 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|