C20H19N3O3S — CID 66488350
4-[3-(3,4-dimethoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-5H-1,3-thiazol-2-one (PubChem CID 66488350) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is 4-[3-(3,4-dimethoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-5H-1,3-thiazol-2-one.
| Compound Name | 4-[3-(3,4-dimethoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-5H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 66488350 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 4-[3-(3,4-dimethoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-5H-1,3-thiazol-2-one |
| SMILES | COc1ccc(C2CC(c3ccccc3)=NN2C2=NC(=O)SC2)cc1OC |
| InChI | InChI=1S/C20H19N3O3S/c1-25-17-9-8-14(10-18(17)26-2)16-11-15(13-6-4-3-5-7-13)22-23(16)19-12-27-20(24)21-19/h3-10,16H,11-12H2,1-2H3 |
| InChIKey | VCKUSSVLAXBMDV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|